C16H20N2O2 — CID 122569432
N-[[5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl]oxan-3-amine (PubChem CID 122569432) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is N-[[5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl]oxan-3-amine.
| Compound Name | N-[[5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl]oxan-3-amine |
|---|---|
| PubChem CID | 122569432 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | N-[[5-(4-methylphenyl)-1,2-oxazol-3-yl]methyl]oxan-3-amine |
| SMILES | Cc1ccc(-c2cc(CNC3CCCOC3)no2)cc1 |
| InChI | InChI=1S/C16H20N2O2/c1-12-4-6-13(7-5-12)16-9-15(18-20-16)10-17-14-3-2-8-19-11-14/h4-7,9,14,17H,2-3,8,10-11H2,1H3 |
| InChIKey | KQOFYBBRTZTIIJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |