C19H26IN5O3 — CID 111164300
ethyl 4-[N'-methyl-N-[(5-phenyl-1,2-oxazol-3-yl)methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111164300) has the molecular formula C19H26IN5O3 and a molecular weight of 499.35 g/mol. Its IUPAC name is ethyl 4-[N'-methyl-N-[(5-phenyl-1,2-oxazol-3-yl)methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[N'-methyl-N-[(5-phenyl-1,2-oxazol-3-yl)methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111164300 |
| Molecular Formula | C19H26IN5O3 |
| Molecular Weight | 499.35 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | ethyl 4-[N'-methyl-N-[(5-phenyl-1,2-oxazol-3-yl)methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCN(/C(=N/C)NCc2cc(-c3ccccc3)on2)CC1.I |
| InChI | InChI=1S/C19H25N5O3.HI/c1-3-26-19(25)24-11-9-23(10-12-24)18(20-2)21-14-16-13-17(27-22-16)15-7-5-4-6-8-15;/h4-8,13H,3,9-12,14H2,1-2H3,(H,20,21);1H |
| InChIKey | WXLLFCLSWDYTMC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|