C21H35IN4O4 — CID 111164190
ethyl 4-[N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111164190) has the molecular formula C21H35IN4O4 and a molecular weight of 534.44 g/mol. Its IUPAC name is ethyl 4-[N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111164190 |
| Molecular Formula | C21H35IN4O4 |
| Molecular Weight | 534.44 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | ethyl 4-[N-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CCOCCOCc1cccc(CN/C(=N\C)N2CCN(C(=O)OCC)CC2)c1.I |
| InChI | InChI=1S/C21H34N4O4.HI/c1-4-27-13-14-28-17-19-8-6-7-18(15-19)16-23-20(22-3)24-9-11-25(12-10-24)21(26)29-5-2;/h6-8,15H,4-5,9-14,16-17H2,1-3H3,(H,22,23);1H |
| InChIKey | ZJMUWFHZJXFHAG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|