C22H18N2O3S — CID 71934163
2-phenyl-N-[(5-phenyl-1,2-oxazol-3-yl)methyl]benzenesulfonamide (PubChem CID 71934163) has the molecular formula C22H18N2O3S and a molecular weight of 390.46 g/mol. Its IUPAC name is 2-phenyl-N-[(5-phenyl-1,2-oxazol-3-yl)methyl]benzenesulfonamide.
| Compound Name | 2-phenyl-N-[(5-phenyl-1,2-oxazol-3-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 71934163 |
| Molecular Formula | C22H18N2O3S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 2-phenyl-N-[(5-phenyl-1,2-oxazol-3-yl)methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCc1cc(-c2ccccc2)on1)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C22H18N2O3S/c25-28(26,22-14-8-7-13-20(22)17-9-3-1-4-10-17)23-16-19-15-21(27-24-19)18-11-5-2-6-12-18/h1-15,23H,16H2 |
| InChIKey | KFQARWQOYAVRCP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |