C13H15N5O2S2 — CID 56789648
2-[(1-ethylbenzimidazol-2-yl)methylamino]-1,3-thiazole-5-sulfonamide (PubChem CID 56789648) has the molecular formula C13H15N5O2S2 and a molecular weight of 337.43 g/mol. Its IUPAC name is 2-[(1-ethylbenzimidazol-2-yl)methylamino]-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-[(1-ethylbenzimidazol-2-yl)methylamino]-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 56789648 |
| Molecular Formula | C13H15N5O2S2 |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 2-[(1-ethylbenzimidazol-2-yl)methylamino]-1,3-thiazole-5-sulfonamide |
| SMILES | CCn1c(CNc2ncc(S(N)(=O)=O)s2)nc2ccccc21 |
| InChI | InChI=1S/C13H15N5O2S2/c1-2-18-10-6-4-3-5-9(10)17-11(18)7-15-13-16-8-12(21-13)22(14,19)20/h3-6,8H,2,7H2,1H3,(H,15,16)(H2,14,19,20) |
| InChIKey | SEQRIWUGSGDWJL-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |