About 1-N-benzyl-1-N-methyl-2-N-[6-(2-methylimidazol-1-yl)pyrazin-2-yl]propane-1,2-diamine
1-N-benzyl-1-N-methyl-2-N-[6-(2-methylimidazol-1-yl)pyrazin-2-yl]propane-1,2-diamine (PubChem CID 133435886) has the molecular formula C19H24N6
and a molecular weight of 336.44 g/mol. Its IUPAC name is 1-N-benzyl-1-N-methyl-2-N-[6-(2-methylimidazol-1-yl)pyrazin-2-yl]propane-1,2-diamine.
Molecular Properties
| Compound Name | 1-N-benzyl-1-N-methyl-2-N-[6-(2-methylimidazol-1-yl)pyrazin-2-yl]propane-1,2-diamine |
| PubChem CID | 133435886 |
| Molecular Formula | C19H24N6 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | 1-N-benzyl-1-N-methyl-2-N-[6-(2-methylimidazol-1-yl)pyrazin-2-yl]propane-1,2-diamine |
| SMILES | Cc1nccn1-c1cncc(NC(C)CN(C)Cc2ccccc2)n1 |
| InChI | InChI=1S/C19H24N6/c1-15(13-24(3)14-17-7-5-4-6-8-17)22-18-11-20-12-19(23-18)25-10-9-21-16(25)2/h4-12,15H,13-14H2,1-3H3,(H,22,23) |
| InChIKey | ZVGJBPDBZFSNIM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-N-benzyl-1-N-methyl-2-N-[6-(2-methylimidazol-1-yl)pyrazin-2-yl]propane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-benzyl-1-N-methyl-2-N-[6-(2-methylimidazol-1-yl)pyrazin-2-yl]propane-1,2-diamine?
The IUPAC name of 1-N-benzyl-1-N-methyl-2-N-[6-(2-methylimidazol-1-yl)pyrazin-2-yl]propane-1,2-diamine (CID 133435886) is 1-N-benzyl-1-N-methyl-2-N-[6-(2-methylimidazol-1-yl)pyrazin-2-yl]propane-1,2-diamine.
What is the SMILES notation for 1-N-benzyl-1-N-methyl-2-N-[6-(2-methylimidazol-1-yl)pyrazin-2-yl]propane-1,2-diamine?
The canonical SMILES for 1-N-benzyl-1-N-methyl-2-N-[6-(2-methylimidazol-1-yl)pyrazin-2-yl]propane-1,2-diamine is Cc1nccn1-c1cncc(NC(C)CN(C)Cc2ccccc2)n1.
What is the InChIKey of 1-N-benzyl-1-N-methyl-2-N-[6-(2-methylimidazol-1-yl)pyrazin-2-yl]propane-1,2-diamine?
The InChIKey is ZVGJBPDBZFSNIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N6/c1-15(13-24(3)14-17-7-5-4-6-8-17)22-18-11-20-12-19(23-18)25-10-9-21-16(25)2/h4-12,15H,13-14H2,1-3H3,(H,22,23).
What are the key properties of 1-N-benzyl-1-N-methyl-2-N-[6-(2-methylimidazol-1-yl)pyrazin-2-yl]propane-1,2-diamine?
1-N-benzyl-1-N-methyl-2-N-[6-(2-methylimidazol-1-yl)pyrazin-2-yl]propane-1,2-diamine has a molecular weight of 336.44 g/mol, XLogP of 2.90, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-benzyl-1-N-methyl-2-N-[6-(2-methylimidazol-1-yl)pyrazin-2-yl]propane-1,2-diamine is sourced from PubChem (CID 133435886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).