C13H13N3O3S2 — CID 51106873
2-[1-(1-benzofuran-2-yl)ethylamino]-1,3-thiazole-5-sulfonamide (PubChem CID 51106873) has the molecular formula C13H13N3O3S2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 2-[1-(1-benzofuran-2-yl)ethylamino]-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-[1-(1-benzofuran-2-yl)ethylamino]-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 51106873 |
| Molecular Formula | C13H13N3O3S2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 2-[1-(1-benzofuran-2-yl)ethylamino]-1,3-thiazole-5-sulfonamide |
| SMILES | CC(Nc1ncc(S(N)(=O)=O)s1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C13H13N3O3S2/c1-8(11-6-9-4-2-3-5-10(9)19-11)16-13-15-7-12(20-13)21(14,17)18/h2-8H,1H3,(H,15,16)(H2,14,17,18) |
| InChIKey | UEOSJBKTQHCLOK-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |