C16H16N2O5S2 — CID 86916872
3-N-[1-(1-benzofuran-2-yl)ethyl]benzene-1,3-disulfonamide (PubChem CID 86916872) has the molecular formula C16H16N2O5S2 and a molecular weight of 380.45 g/mol. Its IUPAC name is 3-N-[1-(1-benzofuran-2-yl)ethyl]benzene-1,3-disulfonamide.
| Compound Name | 3-N-[1-(1-benzofuran-2-yl)ethyl]benzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 86916872 |
| Molecular Formula | C16H16N2O5S2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | 3-N-[1-(1-benzofuran-2-yl)ethyl]benzene-1,3-disulfonamide |
| SMILES | CC(NS(=O)(=O)c1cccc(S(N)(=O)=O)c1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C16H16N2O5S2/c1-11(16-9-12-5-2-3-8-15(12)23-16)18-25(21,22)14-7-4-6-13(10-14)24(17,19)20/h2-11,18H,1H3,(H2,17,19,20) |
| InChIKey | XTBQDWKXJDGVMJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |