C20H20N2O4S — CID 51206832
N-[1-(1-benzofuran-2-yl)ethyl]-3-(cyclopropylsulfamoyl)benzamide (PubChem CID 51206832) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is N-[1-(1-benzofuran-2-yl)ethyl]-3-(cyclopropylsulfamoyl)benzamide.
| Compound Name | N-[1-(1-benzofuran-2-yl)ethyl]-3-(cyclopropylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 51206832 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | N-[1-(1-benzofuran-2-yl)ethyl]-3-(cyclopropylsulfamoyl)benzamide |
| SMILES | CC(NC(=O)c1cccc(S(=O)(=O)NC2CC2)c1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C20H20N2O4S/c1-13(19-12-14-5-2-3-8-18(14)26-19)21-20(23)15-6-4-7-17(11-15)27(24,25)22-16-9-10-16/h2-8,11-13,16,22H,9-10H2,1H3,(H,21,23) |
| InChIKey | ISUIGRZJUXSLOK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |