C23H26N2O5S — CID 55588486
3-(cyclopentylsulfamoyl)-N-[1-(7-methoxy-1-benzofuran-2-yl)ethyl]benzamide (PubChem CID 55588486) has the molecular formula C23H26N2O5S and a molecular weight of 442.54 g/mol. Its IUPAC name is 3-(cyclopentylsulfamoyl)-N-[1-(7-methoxy-1-benzofuran-2-yl)ethyl]benzamide.
| Compound Name | 3-(cyclopentylsulfamoyl)-N-[1-(7-methoxy-1-benzofuran-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 55588486 |
| Molecular Formula | C23H26N2O5S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 3-(cyclopentylsulfamoyl)-N-[1-(7-methoxy-1-benzofuran-2-yl)ethyl]benzamide |
| SMILES | COc1cccc2cc(C(C)NC(=O)c3cccc(S(=O)(=O)NC4CCCC4)c3)oc12 |
| InChI | InChI=1S/C23H26N2O5S/c1-15(21-14-16-7-6-12-20(29-2)22(16)30-21)24-23(26)17-8-5-11-19(13-17)31(27,28)25-18-9-3-4-10-18/h5-8,11-15,18,25H,3-4,9-10H2,1-2H3,(H,24,26) |
| InChIKey | OUFSDCPIXIKKDC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |