C20H21NO4S — CID 46489933
N-[1-(1-benzofuran-2-yl)ethyl]-4-propan-2-ylsulfonylbenzamide (PubChem CID 46489933) has the molecular formula C20H21NO4S and a molecular weight of 371.46 g/mol. Its IUPAC name is N-[1-(1-benzofuran-2-yl)ethyl]-4-propan-2-ylsulfonylbenzamide.
| Compound Name | N-[1-(1-benzofuran-2-yl)ethyl]-4-propan-2-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 46489933 |
| Molecular Formula | C20H21NO4S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | N-[1-(1-benzofuran-2-yl)ethyl]-4-propan-2-ylsulfonylbenzamide |
| SMILES | CC(NC(=O)c1ccc(S(=O)(=O)C(C)C)cc1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C20H21NO4S/c1-13(2)26(23,24)17-10-8-15(9-11-17)20(22)21-14(3)19-12-16-6-4-5-7-18(16)25-19/h4-14H,1-3H3,(H,21,22) |
| InChIKey | BQNZEZFLYNAVDF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |