C19H19NO4S — CID 51579914
N-[(1S)-1-(1-benzofuran-2-yl)ethyl]-2-methyl-5-methylsulfonylbenzamide (PubChem CID 51579914) has the molecular formula C19H19NO4S and a molecular weight of 357.43 g/mol. Its IUPAC name is N-[(1S)-1-(1-benzofuran-2-yl)ethyl]-2-methyl-5-methylsulfonylbenzamide.
| Compound Name | N-[(1S)-1-(1-benzofuran-2-yl)ethyl]-2-methyl-5-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 51579914 |
| Molecular Formula | C19H19NO4S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | N-[(1S)-1-(1-benzofuran-2-yl)ethyl]-2-methyl-5-methylsulfonylbenzamide |
| SMILES | Cc1ccc(S(C)(=O)=O)cc1C(=O)N[C@@H](C)c1cc2ccccc2o1 |
| InChI | InChI=1S/C19H19NO4S/c1-12-8-9-15(25(3,22)23)11-16(12)19(21)20-13(2)18-10-14-6-4-5-7-17(14)24-18/h4-11,13H,1-3H3,(H,20,21)/t13-/m0/s1 |
| InChIKey | ZAFLRIKWWFYYJU-ZDUSSCGKSA-N |
| XLogP | 3.64 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |