C15H17NO3S2 — CID 51072491
2-methyl-5-methylsulfonyl-N-(1-thiophen-2-ylethyl)benzamide (PubChem CID 51072491) has the molecular formula C15H17NO3S2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 2-methyl-5-methylsulfonyl-N-(1-thiophen-2-ylethyl)benzamide.
| Compound Name | 2-methyl-5-methylsulfonyl-N-(1-thiophen-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 51072491 |
| Molecular Formula | C15H17NO3S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 2-methyl-5-methylsulfonyl-N-(1-thiophen-2-ylethyl)benzamide |
| SMILES | Cc1ccc(S(C)(=O)=O)cc1C(=O)NC(C)c1cccs1 |
| InChI | InChI=1S/C15H17NO3S2/c1-10-6-7-12(21(3,18)19)9-13(10)15(17)16-11(2)14-5-4-8-20-14/h4-9,11H,1-3H3,(H,16,17) |
| InChIKey | WJXGIUPYXBEXGB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |