C21H20N2O2 — CID 43060113
N-[1-(1-benzofuran-2-yl)ethyl]-2,3-dimethyl-1H-indole-7-carboxamide (PubChem CID 43060113) has the molecular formula C21H20N2O2 and a molecular weight of 332.40 g/mol. Its IUPAC name is N-[1-(1-benzofuran-2-yl)ethyl]-2,3-dimethyl-1H-indole-7-carboxamide.
| Compound Name | N-[1-(1-benzofuran-2-yl)ethyl]-2,3-dimethyl-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 43060113 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | N-[1-(1-benzofuran-2-yl)ethyl]-2,3-dimethyl-1H-indole-7-carboxamide |
| SMILES | Cc1[nH]c2c(C(=O)NC(C)c3cc4ccccc4o3)cccc2c1C |
| InChI | InChI=1S/C21H20N2O2/c1-12-13(2)22-20-16(12)8-6-9-17(20)21(24)23-14(3)19-11-15-7-4-5-10-18(15)25-19/h4-11,14,22H,1-3H3,(H,23,24) |
| InChIKey | VLPQCNHWAFLTBG-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|