C16H12F3NO3S — CID 9189706
N-[(1R)-1-(1-benzofuran-2-yl)ethyl]-2,3,4-trifluorobenzenesulfonamide (PubChem CID 9189706) has the molecular formula C16H12F3NO3S and a molecular weight of 355.34 g/mol. Its IUPAC name is N-[(1R)-1-(1-benzofuran-2-yl)ethyl]-2,3,4-trifluorobenzenesulfonamide.
| Compound Name | N-[(1R)-1-(1-benzofuran-2-yl)ethyl]-2,3,4-trifluorobenzenesulfonamide |
|---|---|
| PubChem CID | 9189706 |
| Molecular Formula | C16H12F3NO3S |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | N-[(1R)-1-(1-benzofuran-2-yl)ethyl]-2,3,4-trifluorobenzenesulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)c1ccc(F)c(F)c1F)c1cc2ccccc2o1 |
| InChI | InChI=1S/C16H12F3NO3S/c1-9(13-8-10-4-2-3-5-12(10)23-13)20-24(21,22)14-7-6-11(17)15(18)16(14)19/h2-9,20H,1H3/t9-/m1/s1 |
| InChIKey | QFLHCWQNMVGNOS-SECBINFHSA-N |
| XLogP | 3.89 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|