C12H10F3NO3S — CID 8817589
2,3,4-trifluoro-N-[(1S)-1-(furan-2-yl)ethyl]benzenesulfonamide (PubChem CID 8817589) has the molecular formula C12H10F3NO3S and a molecular weight of 305.28 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[(1S)-1-(furan-2-yl)ethyl]benzenesulfonamide.
| Compound Name | 2,3,4-trifluoro-N-[(1S)-1-(furan-2-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 8817589 |
| Molecular Formula | C12H10F3NO3S |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 2,3,4-trifluoro-N-[(1S)-1-(furan-2-yl)ethyl]benzenesulfonamide |
| SMILES | C[C@H](NS(=O)(=O)c1ccc(F)c(F)c1F)c1ccco1 |
| InChI | InChI=1S/C12H10F3NO3S/c1-7(9-3-2-6-19-9)16-20(17,18)10-5-4-8(13)11(14)12(10)15/h2-7,16H,1H3/t7-/m0/s1 |
| InChIKey | XQXKINWIHRMOBQ-ZETCQYMHSA-N |
| XLogP | 2.74 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|