C13H12FNO5S — CID 81390250
3-fluoro-4-[[(1S)-1-(furan-2-yl)ethyl]sulfamoyl]benzoic acid (PubChem CID 81390250) has the molecular formula C13H12FNO5S and a molecular weight of 313.31 g/mol. Its IUPAC name is 3-fluoro-4-[[(1S)-1-(furan-2-yl)ethyl]sulfamoyl]benzoic acid.
| Compound Name | 3-fluoro-4-[[(1S)-1-(furan-2-yl)ethyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 81390250 |
| Molecular Formula | C13H12FNO5S |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 3-fluoro-4-[[(1S)-1-(furan-2-yl)ethyl]sulfamoyl]benzoic acid |
| SMILES | C[C@H](NS(=O)(=O)c1ccc(C(=O)O)cc1F)c1ccco1 |
| InChI | InChI=1S/C13H12FNO5S/c1-8(11-3-2-6-20-11)15-21(18,19)12-5-4-9(13(16)17)7-10(12)14/h2-8,15H,1H3,(H,16,17)/t8-/m0/s1 |
| InChIKey | KSQHXRYWBBSOOV-QMMMGPOBSA-N |
| XLogP | 2.16 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |