C10H10FN5O4S — CID 79177706
3-fluoro-4-[1-(2H-tetrazol-5-yl)ethylsulfamoyl]benzoic acid (PubChem CID 79177706) has the molecular formula C10H10FN5O4S and a molecular weight of 315.29 g/mol. Its IUPAC name is 3-fluoro-4-[1-(2H-tetrazol-5-yl)ethylsulfamoyl]benzoic acid.
| Compound Name | 3-fluoro-4-[1-(2H-tetrazol-5-yl)ethylsulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 79177706 |
| Molecular Formula | C10H10FN5O4S |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 3-fluoro-4-[1-(2H-tetrazol-5-yl)ethylsulfamoyl]benzoic acid |
| SMILES | CC(NS(=O)(=O)c1ccc(C(=O)O)cc1F)c1nn[nH]n1 |
| InChI | InChI=1S/C10H10FN5O4S/c1-5(9-12-15-16-13-9)14-21(19,20)8-3-2-6(10(17)18)4-7(8)11/h2-5,14H,1H3,(H,17,18)(H,12,13,15,16) |
| InChIKey | XFVGQOKYHWWLEZ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 137.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |