C11H15FN6O2S — CID 106051400
2-fluoro-4-(methylaminomethyl)-N-[1-(2H-tetrazol-5-yl)ethyl]benzenesulfonamide (PubChem CID 106051400) has the molecular formula C11H15FN6O2S and a molecular weight of 314.35 g/mol. Its IUPAC name is 2-fluoro-4-(methylaminomethyl)-N-[1-(2H-tetrazol-5-yl)ethyl]benzenesulfonamide.
| Compound Name | 2-fluoro-4-(methylaminomethyl)-N-[1-(2H-tetrazol-5-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106051400 |
| Molecular Formula | C11H15FN6O2S |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 2-fluoro-4-(methylaminomethyl)-N-[1-(2H-tetrazol-5-yl)ethyl]benzenesulfonamide |
| SMILES | CNCc1ccc(S(=O)(=O)NC(C)c2nn[nH]n2)c(F)c1 |
| InChI | InChI=1S/C11H15FN6O2S/c1-7(11-14-17-18-15-11)16-21(19,20)10-4-3-8(6-13-2)5-9(10)12/h3-5,7,13,16H,6H2,1-2H3,(H,14,15,17,18) |
| InChIKey | WLJUWQFWIOTEPG-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |