C11H19N7O2S — CID 106051433
1-ethyl-5-(methylaminomethyl)-N-[1-(2H-tetrazol-5-yl)ethyl]pyrrole-3-sulfonamide (PubChem CID 106051433) has the molecular formula C11H19N7O2S and a molecular weight of 313.39 g/mol. Its IUPAC name is 1-ethyl-5-(methylaminomethyl)-N-[1-(2H-tetrazol-5-yl)ethyl]pyrrole-3-sulfonamide.
| Compound Name | 1-ethyl-5-(methylaminomethyl)-N-[1-(2H-tetrazol-5-yl)ethyl]pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106051433 |
| Molecular Formula | C11H19N7O2S |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 1-ethyl-5-(methylaminomethyl)-N-[1-(2H-tetrazol-5-yl)ethyl]pyrrole-3-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)NC(C)c2nn[nH]n2)cc1CNC |
| InChI | InChI=1S/C11H19N7O2S/c1-4-18-7-10(5-9(18)6-12-3)21(19,20)15-8(2)11-13-16-17-14-11/h5,7-8,12,15H,4,6H2,1-3H3,(H,13,14,16,17) |
| InChIKey | VWTIVPYBPGUQNS-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |