C11H17N7O2S — CID 106051402
5-(aminomethyl)-1-cyclopropyl-N-[1-(2H-tetrazol-5-yl)ethyl]pyrrole-3-sulfonamide (PubChem CID 106051402) has the molecular formula C11H17N7O2S and a molecular weight of 311.37 g/mol. Its IUPAC name is 5-(aminomethyl)-1-cyclopropyl-N-[1-(2H-tetrazol-5-yl)ethyl]pyrrole-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-1-cyclopropyl-N-[1-(2H-tetrazol-5-yl)ethyl]pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106051402 |
| Molecular Formula | C11H17N7O2S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 5-(aminomethyl)-1-cyclopropyl-N-[1-(2H-tetrazol-5-yl)ethyl]pyrrole-3-sulfonamide |
| SMILES | CC(NS(=O)(=O)c1cc(CN)n(C2CC2)c1)c1nn[nH]n1 |
| InChI | InChI=1S/C11H17N7O2S/c1-7(11-13-16-17-14-11)15-21(19,20)10-4-9(5-12)18(6-10)8-2-3-8/h4,6-8,15H,2-3,5,12H2,1H3,(H,13,14,16,17) |
| InChIKey | VPCKFGZFIHGVRM-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 131.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |