C14H26N4O2S — CID 106054923
5-(aminomethyl)-1-cyclopropyl-N-[4-(dimethylamino)butan-2-yl]pyrrole-3-sulfonamide (PubChem CID 106054923) has the molecular formula C14H26N4O2S and a molecular weight of 314.46 g/mol. Its IUPAC name is 5-(aminomethyl)-1-cyclopropyl-N-[4-(dimethylamino)butan-2-yl]pyrrole-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-1-cyclopropyl-N-[4-(dimethylamino)butan-2-yl]pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106054923 |
| Molecular Formula | C14H26N4O2S |
| Molecular Weight | 314.46 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 5-(aminomethyl)-1-cyclopropyl-N-[4-(dimethylamino)butan-2-yl]pyrrole-3-sulfonamide |
| SMILES | CC(CCN(C)C)NS(=O)(=O)c1cc(CN)n(C2CC2)c1 |
| InChI | InChI=1S/C14H26N4O2S/c1-11(6-7-17(2)3)16-21(19,20)14-8-13(9-15)18(10-14)12-4-5-12/h8,10-12,16H,4-7,9,15H2,1-3H3 |
| InChIKey | DOZLGUQSYBXKON-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 80.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.46 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |