C12H23N3O2S — CID 114140372
5-(aminomethyl)-1-ethyl-N-pentan-2-ylpyrrole-3-sulfonamide (PubChem CID 114140372) has the molecular formula C12H23N3O2S and a molecular weight of 273.40 g/mol. Its IUPAC name is 5-(aminomethyl)-1-ethyl-N-pentan-2-ylpyrrole-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-1-ethyl-N-pentan-2-ylpyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 114140372 |
| Molecular Formula | C12H23N3O2S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 5-(aminomethyl)-1-ethyl-N-pentan-2-ylpyrrole-3-sulfonamide |
| SMILES | CCCC(C)NS(=O)(=O)c1cc(CN)n(CC)c1 |
| InChI | InChI=1S/C12H23N3O2S/c1-4-6-10(3)14-18(16,17)12-7-11(8-13)15(5-2)9-12/h7,9-10,14H,4-6,8,13H2,1-3H3 |
| InChIKey | QXWWOHJKOGTKMT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |