C14H27N3O2S — CID 106055445
5-(aminomethyl)-N-hexan-3-yl-1-propan-2-ylpyrrole-3-sulfonamide (PubChem CID 106055445) has the molecular formula C14H27N3O2S and a molecular weight of 301.46 g/mol. Its IUPAC name is 5-(aminomethyl)-N-hexan-3-yl-1-propan-2-ylpyrrole-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-hexan-3-yl-1-propan-2-ylpyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106055445 |
| Molecular Formula | C14H27N3O2S |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 5-(aminomethyl)-N-hexan-3-yl-1-propan-2-ylpyrrole-3-sulfonamide |
| SMILES | CCCC(CC)NS(=O)(=O)c1cc(CN)n(C(C)C)c1 |
| InChI | InChI=1S/C14H27N3O2S/c1-5-7-12(6-2)16-20(18,19)14-8-13(9-15)17(10-14)11(3)4/h8,10-12,16H,5-7,9,15H2,1-4H3 |
| InChIKey | WLRRQNUYSGFWOC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |