C13H25N3O3S — CID 106067591
5-(aminomethyl)-N-(4-methoxybutan-2-yl)-1-propan-2-ylpyrrole-3-sulfonamide (PubChem CID 106067591) has the molecular formula C13H25N3O3S and a molecular weight of 303.43 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(4-methoxybutan-2-yl)-1-propan-2-ylpyrrole-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-(4-methoxybutan-2-yl)-1-propan-2-ylpyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106067591 |
| Molecular Formula | C13H25N3O3S |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 5-(aminomethyl)-N-(4-methoxybutan-2-yl)-1-propan-2-ylpyrrole-3-sulfonamide |
| SMILES | COCCC(C)NS(=O)(=O)c1cc(CN)n(C(C)C)c1 |
| InChI | InChI=1S/C13H25N3O3S/c1-10(2)16-9-13(7-12(16)8-14)20(17,18)15-11(3)5-6-19-4/h7,9-11,15H,5-6,8,14H2,1-4H3 |
| InChIKey | LSSLTMFYAGZHRR-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |