C10H17N7O2S — CID 106051316
5-(aminomethyl)-1-ethyl-N-[1-(2H-tetrazol-5-yl)ethyl]pyrrole-3-sulfonamide (PubChem CID 106051316) has the molecular formula C10H17N7O2S and a molecular weight of 299.36 g/mol. Its IUPAC name is 5-(aminomethyl)-1-ethyl-N-[1-(2H-tetrazol-5-yl)ethyl]pyrrole-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-1-ethyl-N-[1-(2H-tetrazol-5-yl)ethyl]pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106051316 |
| Molecular Formula | C10H17N7O2S |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 5-(aminomethyl)-1-ethyl-N-[1-(2H-tetrazol-5-yl)ethyl]pyrrole-3-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)NC(C)c2nn[nH]n2)cc1CN |
| InChI | InChI=1S/C10H17N7O2S/c1-3-17-6-9(4-8(17)5-11)20(18,19)14-7(2)10-12-15-16-13-10/h4,6-7,14H,3,5,11H2,1-2H3,(H,12,13,15,16) |
| InChIKey | YTTIKQUKYJVUKE-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 131.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |