C14H25N3O3S — CID 106054197
1-cyclopropyl-N-(1-ethoxypropan-2-yl)-5-(methylaminomethyl)pyrrole-3-sulfonamide (PubChem CID 106054197) has the molecular formula C14H25N3O3S and a molecular weight of 315.44 g/mol. Its IUPAC name is 1-cyclopropyl-N-(1-ethoxypropan-2-yl)-5-(methylaminomethyl)pyrrole-3-sulfonamide.
| Compound Name | 1-cyclopropyl-N-(1-ethoxypropan-2-yl)-5-(methylaminomethyl)pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106054197 |
| Molecular Formula | C14H25N3O3S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 1-cyclopropyl-N-(1-ethoxypropan-2-yl)-5-(methylaminomethyl)pyrrole-3-sulfonamide |
| SMILES | CCOCC(C)NS(=O)(=O)c1cc(CNC)n(C2CC2)c1 |
| InChI | InChI=1S/C14H25N3O3S/c1-4-20-10-11(2)16-21(18,19)14-7-13(8-15-3)17(9-14)12-5-6-12/h7,9,11-12,15-16H,4-6,8,10H2,1-3H3 |
| InChIKey | YEPGZCMUFLVOGM-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |