C13H19N5O2S — CID 106015962
1-cyclopropyl-5-(methylaminomethyl)-N-(1H-pyrazol-4-ylmethyl)pyrrole-3-sulfonamide (PubChem CID 106015962) has the molecular formula C13H19N5O2S and a molecular weight of 309.40 g/mol. Its IUPAC name is 1-cyclopropyl-5-(methylaminomethyl)-N-(1H-pyrazol-4-ylmethyl)pyrrole-3-sulfonamide.
| Compound Name | 1-cyclopropyl-5-(methylaminomethyl)-N-(1H-pyrazol-4-ylmethyl)pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106015962 |
| Molecular Formula | C13H19N5O2S |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 1-cyclopropyl-5-(methylaminomethyl)-N-(1H-pyrazol-4-ylmethyl)pyrrole-3-sulfonamide |
| SMILES | CNCc1cc(S(=O)(=O)NCc2cn[nH]c2)cn1C1CC1 |
| InChI | InChI=1S/C13H19N5O2S/c1-14-8-12-4-13(9-18(12)11-2-3-11)21(19,20)17-7-10-5-15-16-6-10/h4-6,9,11,14,17H,2-3,7-8H2,1H3,(H,15,16) |
| InChIKey | VVPGZDGUYCVWGS-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |