C13H21N3O3S — CID 106076278
5-(aminomethyl)-1-cyclopropyl-N-(2-methyloxolan-3-yl)pyrrole-3-sulfonamide (PubChem CID 106076278) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is 5-(aminomethyl)-1-cyclopropyl-N-(2-methyloxolan-3-yl)pyrrole-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-1-cyclopropyl-N-(2-methyloxolan-3-yl)pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106076278 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 5-(aminomethyl)-1-cyclopropyl-N-(2-methyloxolan-3-yl)pyrrole-3-sulfonamide |
| SMILES | CC1OCCC1NS(=O)(=O)c1cc(CN)n(C2CC2)c1 |
| InChI | InChI=1S/C13H21N3O3S/c1-9-13(4-5-19-9)15-20(17,18)12-6-11(7-14)16(8-12)10-2-3-10/h6,8-10,13,15H,2-5,7,14H2,1H3 |
| InChIKey | ZNNCZKGGRWVYDE-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |