C12H18N6O2S — CID 106051321
3-(ethylaminomethyl)-N-[1-(2H-tetrazol-5-yl)ethyl]benzenesulfonamide (PubChem CID 106051321) has the molecular formula C12H18N6O2S and a molecular weight of 310.38 g/mol. Its IUPAC name is 3-(ethylaminomethyl)-N-[1-(2H-tetrazol-5-yl)ethyl]benzenesulfonamide.
| Compound Name | 3-(ethylaminomethyl)-N-[1-(2H-tetrazol-5-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106051321 |
| Molecular Formula | C12H18N6O2S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 3-(ethylaminomethyl)-N-[1-(2H-tetrazol-5-yl)ethyl]benzenesulfonamide |
| SMILES | CCNCc1cccc(S(=O)(=O)NC(C)c2nn[nH]n2)c1 |
| InChI | InChI=1S/C12H18N6O2S/c1-3-13-8-10-5-4-6-11(7-10)21(19,20)16-9(2)12-14-17-18-15-12/h4-7,9,13,16H,3,8H2,1-2H3,(H,14,15,17,18) |
| InChIKey | WABQSNGSRZVITK-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |