C8H18N6O2S — CID 106051367
3-(ethylamino)-N-[1-(2H-tetrazol-5-yl)ethyl]propane-1-sulfonamide (PubChem CID 106051367) has the molecular formula C8H18N6O2S and a molecular weight of 262.34 g/mol. Its IUPAC name is 3-(ethylamino)-N-[1-(2H-tetrazol-5-yl)ethyl]propane-1-sulfonamide.
| Compound Name | 3-(ethylamino)-N-[1-(2H-tetrazol-5-yl)ethyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 106051367 |
| Molecular Formula | C8H18N6O2S |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 3-(ethylamino)-N-[1-(2H-tetrazol-5-yl)ethyl]propane-1-sulfonamide |
| SMILES | CCNCCCS(=O)(=O)NC(C)c1nn[nH]n1 |
| InChI | InChI=1S/C8H18N6O2S/c1-3-9-5-4-6-17(15,16)12-7(2)8-10-13-14-11-8/h7,9,12H,3-6H2,1-2H3,(H,10,11,13,14) |
| InChIKey | RDUBLHCDSORKHP-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|