C5H10ClN5O2S — CID 107651825
2-chloro-N-[1-(2H-tetrazol-5-yl)ethyl]ethanesulfonamide (PubChem CID 107651825) has the molecular formula C5H10ClN5O2S and a molecular weight of 239.69 g/mol. Its IUPAC name is 2-chloro-N-[1-(2H-tetrazol-5-yl)ethyl]ethanesulfonamide.
| Compound Name | 2-chloro-N-[1-(2H-tetrazol-5-yl)ethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 107651825 |
| Molecular Formula | C5H10ClN5O2S |
| Molecular Weight | 239.69 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | 2-chloro-N-[1-(2H-tetrazol-5-yl)ethyl]ethanesulfonamide |
| SMILES | CC(NS(=O)(=O)CCCl)c1nn[nH]n1 |
| InChI | InChI=1S/C5H10ClN5O2S/c1-4(5-7-10-11-8-5)9-14(12,13)3-2-6/h4,9H,2-3H2,1H3,(H,7,8,10,11) |
| InChIKey | LFQBRIICRHCXIT-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.69 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|