C7H16N6O2S — CID 106051381
1-(methylamino)-N-[1-(2H-tetrazol-5-yl)ethyl]propane-2-sulfonamide (PubChem CID 106051381) has the molecular formula C7H16N6O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is 1-(methylamino)-N-[1-(2H-tetrazol-5-yl)ethyl]propane-2-sulfonamide.
| Compound Name | 1-(methylamino)-N-[1-(2H-tetrazol-5-yl)ethyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 106051381 |
| Molecular Formula | C7H16N6O2S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 1-(methylamino)-N-[1-(2H-tetrazol-5-yl)ethyl]propane-2-sulfonamide |
| SMILES | CNCC(C)S(=O)(=O)NC(C)c1nn[nH]n1 |
| InChI | InChI=1S/C7H16N6O2S/c1-5(4-8-3)16(14,15)11-6(2)7-9-12-13-10-7/h5-6,8,11H,4H2,1-3H3,(H,9,10,12,13) |
| InChIKey | NGFZTHKXHTYIMO-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |