C11H13N5O2S — CID 78977229
2-phenyl-N-[1-(2H-tetrazol-5-yl)ethyl]ethenesulfonamide (PubChem CID 78977229) has the molecular formula C11H13N5O2S and a molecular weight of 279.33 g/mol. Its IUPAC name is 2-phenyl-N-[1-(2H-tetrazol-5-yl)ethyl]ethenesulfonamide.
| Compound Name | 2-phenyl-N-[1-(2H-tetrazol-5-yl)ethyl]ethenesulfonamide |
|---|---|
| PubChem CID | 78977229 |
| Molecular Formula | C11H13N5O2S |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 2-phenyl-N-[1-(2H-tetrazol-5-yl)ethyl]ethenesulfonamide |
| SMILES | CC(NS(=O)(=O)C=Cc1ccccc1)c1nn[nH]n1 |
| InChI | InChI=1S/C11H13N5O2S/c1-9(11-12-15-16-13-11)14-19(17,18)8-7-10-5-3-2-4-6-10/h2-9,14H,1H3,(H,12,13,15,16) |
| InChIKey | BTBAJQWHIBRTOX-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |