C16H21N3O6S — CID 3530916
[2-(carbamoylamino)-2-oxoethyl] 3-methyl-2-(2-phenylethenylsulfonylamino)butanoate (PubChem CID 3530916) has the molecular formula C16H21N3O6S and a molecular weight of 383.43 g/mol. Its IUPAC name is [2-(carbamoylamino)-2-oxoethyl] 3-methyl-2-(2-phenylethenylsulfonylamino)butanoate.
| Compound Name | [2-(carbamoylamino)-2-oxoethyl] 3-methyl-2-(2-phenylethenylsulfonylamino)butanoate |
|---|---|
| PubChem CID | 3530916 |
| Molecular Formula | C16H21N3O6S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | [2-(carbamoylamino)-2-oxoethyl] 3-methyl-2-(2-phenylethenylsulfonylamino)butanoate |
| SMILES | CC(C)C(NS(=O)(=O)C=Cc1ccccc1)C(=O)OCC(=O)NC(N)=O |
| InChI | InChI=1S/C16H21N3O6S/c1-11(2)14(15(21)25-10-13(20)18-16(17)22)19-26(23,24)9-8-12-6-4-3-5-7-12/h3-9,11,14,19H,10H2,1-2H3,(H3,17,18,20,22) |
| InChIKey | ITMUADQBPVEUHM-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |