C28H30N2O5S — CID 3873515
[2-(benzhydrylamino)-2-oxoethyl] 3-methyl-2-(2-phenylethenylsulfonylamino)butanoate (PubChem CID 3873515) has the molecular formula C28H30N2O5S and a molecular weight of 506.62 g/mol. Its IUPAC name is [2-(benzhydrylamino)-2-oxoethyl] 3-methyl-2-(2-phenylethenylsulfonylamino)butanoate.
| Compound Name | [2-(benzhydrylamino)-2-oxoethyl] 3-methyl-2-(2-phenylethenylsulfonylamino)butanoate |
|---|---|
| PubChem CID | 3873515 |
| Molecular Formula | C28H30N2O5S |
| Molecular Weight | 506.62 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | [2-(benzhydrylamino)-2-oxoethyl] 3-methyl-2-(2-phenylethenylsulfonylamino)butanoate |
| SMILES | CC(C)C(NS(=O)(=O)C=Cc1ccccc1)C(=O)OCC(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H30N2O5S/c1-21(2)26(30-36(33,34)19-18-22-12-6-3-7-13-22)28(32)35-20-25(31)29-27(23-14-8-4-9-15-23)24-16-10-5-11-17-24/h3-19,21,26-27,30H,20H2,1-2H3,(H,29,31) |
| InChIKey | SYZMOAVHUQPYKW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.62 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |