C13H21FN2O2S2 — CID 106083931
2-fluoro-4-(methylaminomethyl)-N-(1-methylsulfanylbutan-2-yl)benzenesulfonamide (PubChem CID 106083931) has the molecular formula C13H21FN2O2S2 and a molecular weight of 320.46 g/mol. Its IUPAC name is 2-fluoro-4-(methylaminomethyl)-N-(1-methylsulfanylbutan-2-yl)benzenesulfonamide.
| Compound Name | 2-fluoro-4-(methylaminomethyl)-N-(1-methylsulfanylbutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 106083931 |
| Molecular Formula | C13H21FN2O2S2 |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 2-fluoro-4-(methylaminomethyl)-N-(1-methylsulfanylbutan-2-yl)benzenesulfonamide |
| SMILES | CCC(CSC)NS(=O)(=O)c1ccc(CNC)cc1F |
| InChI | InChI=1S/C13H21FN2O2S2/c1-4-11(9-19-3)16-20(17,18)13-6-5-10(8-15-2)7-12(13)14/h5-7,11,15-16H,4,8-9H2,1-3H3 |
| InChIKey | MLLMRNCHZGYSPR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |