C14H23FN2O2S — CID 79187326
2-fluoro-N-methyl-4-(methylaminomethyl)-N-pentan-3-ylbenzenesulfonamide (PubChem CID 79187326) has the molecular formula C14H23FN2O2S and a molecular weight of 302.42 g/mol. Its IUPAC name is 2-fluoro-N-methyl-4-(methylaminomethyl)-N-pentan-3-ylbenzenesulfonamide.
| Compound Name | 2-fluoro-N-methyl-4-(methylaminomethyl)-N-pentan-3-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 79187326 |
| Molecular Formula | C14H23FN2O2S |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 2-fluoro-N-methyl-4-(methylaminomethyl)-N-pentan-3-ylbenzenesulfonamide |
| SMILES | CCC(CC)N(C)S(=O)(=O)c1ccc(CNC)cc1F |
| InChI | InChI=1S/C14H23FN2O2S/c1-5-12(6-2)17(4)20(18,19)14-8-7-11(10-16-3)9-13(14)15/h7-9,12,16H,5-6,10H2,1-4H3 |
| InChIKey | GPMWVLQQYOEBFA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |