C15H20FNO3S — CID 116528987
2-fluoro-4-(3-hydroxyprop-1-ynyl)-N-methyl-N-pentan-3-ylbenzenesulfonamide (PubChem CID 116528987) has the molecular formula C15H20FNO3S and a molecular weight of 313.39 g/mol. Its IUPAC name is 2-fluoro-4-(3-hydroxyprop-1-ynyl)-N-methyl-N-pentan-3-ylbenzenesulfonamide.
| Compound Name | 2-fluoro-4-(3-hydroxyprop-1-ynyl)-N-methyl-N-pentan-3-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 116528987 |
| Molecular Formula | C15H20FNO3S |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 2-fluoro-4-(3-hydroxyprop-1-ynyl)-N-methyl-N-pentan-3-ylbenzenesulfonamide |
| SMILES | CCC(CC)N(C)S(=O)(=O)c1ccc(C#CCO)cc1F |
| InChI | InChI=1S/C15H20FNO3S/c1-4-13(5-2)17(3)21(19,20)15-9-8-12(7-6-10-18)11-14(15)16/h8-9,11,13,18H,4-5,10H2,1-3H3 |
| InChIKey | BWRQJXVEEOQJAV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|