C15H20FNO3S — CID 116529080
N-(2,2-dimethylpropyl)-2-fluoro-4-(3-hydroxyprop-1-ynyl)-N-methylbenzenesulfonamide (PubChem CID 116529080) has the molecular formula C15H20FNO3S and a molecular weight of 313.39 g/mol. Its IUPAC name is N-(2,2-dimethylpropyl)-2-fluoro-4-(3-hydroxyprop-1-ynyl)-N-methylbenzenesulfonamide.
| Compound Name | N-(2,2-dimethylpropyl)-2-fluoro-4-(3-hydroxyprop-1-ynyl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 116529080 |
| Molecular Formula | C15H20FNO3S |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | N-(2,2-dimethylpropyl)-2-fluoro-4-(3-hydroxyprop-1-ynyl)-N-methylbenzenesulfonamide |
| SMILES | CN(CC(C)(C)C)S(=O)(=O)c1ccc(C#CCO)cc1F |
| InChI | InChI=1S/C15H20FNO3S/c1-15(2,3)11-17(4)21(19,20)14-8-7-12(6-5-9-18)10-13(14)16/h7-8,10,18H,9,11H2,1-4H3 |
| InChIKey | RTLWLSQBNIQKBG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|