C12H13FN2O4S — CID 116528980
2-[[2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]sulfonylamino]-N-methylacetamide (PubChem CID 116528980) has the molecular formula C12H13FN2O4S and a molecular weight of 300.31 g/mol. Its IUPAC name is 2-[[2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]sulfonylamino]-N-methylacetamide.
| Compound Name | 2-[[2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]sulfonylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 116528980 |
| Molecular Formula | C12H13FN2O4S |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 2-[[2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]sulfonylamino]-N-methylacetamide |
| SMILES | CNC(=O)CNS(=O)(=O)c1ccc(C#CCO)cc1F |
| InChI | InChI=1S/C12H13FN2O4S/c1-14-12(17)8-15-20(18,19)11-5-4-9(3-2-6-16)7-10(11)13/h4-5,7,15-16H,6,8H2,1H3,(H,14,17) |
| InChIKey | MTLJCOZVYTWUMV-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|