C13H11FN2O3S2 — CID 116529219
2-fluoro-4-(3-hydroxyprop-1-ynyl)-N-(1,3-thiazol-5-ylmethyl)benzenesulfonamide (PubChem CID 116529219) has the molecular formula C13H11FN2O3S2 and a molecular weight of 326.37 g/mol. Its IUPAC name is 2-fluoro-4-(3-hydroxyprop-1-ynyl)-N-(1,3-thiazol-5-ylmethyl)benzenesulfonamide.
| Compound Name | 2-fluoro-4-(3-hydroxyprop-1-ynyl)-N-(1,3-thiazol-5-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 116529219 |
| Molecular Formula | C13H11FN2O3S2 |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 2-fluoro-4-(3-hydroxyprop-1-ynyl)-N-(1,3-thiazol-5-ylmethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCc1cncs1)c1ccc(C#CCO)cc1F |
| InChI | InChI=1S/C13H11FN2O3S2/c14-12-6-10(2-1-5-17)3-4-13(12)21(18,19)16-8-11-7-15-9-20-11/h3-4,6-7,9,16-17H,5,8H2 |
| InChIKey | AUMGQSRJBPJGJH-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|