C9H11N7O4S — CID 62158794
5-amino-2-nitro-N-[1-(2H-tetrazol-5-yl)ethyl]benzenesulfonamide (PubChem CID 62158794) has the molecular formula C9H11N7O4S and a molecular weight of 313.30 g/mol. Its IUPAC name is 5-amino-2-nitro-N-[1-(2H-tetrazol-5-yl)ethyl]benzenesulfonamide.
| Compound Name | 5-amino-2-nitro-N-[1-(2H-tetrazol-5-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 62158794 |
| Molecular Formula | C9H11N7O4S |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 5-amino-2-nitro-N-[1-(2H-tetrazol-5-yl)ethyl]benzenesulfonamide |
| SMILES | CC(NS(=O)(=O)c1cc(N)ccc1[N+](=O)[O-])c1nn[nH]n1 |
| InChI | InChI=1S/C9H11N7O4S/c1-5(9-11-14-15-12-9)13-21(19,20)8-4-6(10)2-3-7(8)16(17)18/h2-5,13H,10H2,1H3,(H,11,12,14,15) |
| InChIKey | QYPAVICLESCJSM-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 169.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|