C9H11N7O2 — CID 106749198
4-nitro-1-N-[1-(2H-tetrazol-5-yl)ethyl]benzene-1,3-diamine (PubChem CID 106749198) has the molecular formula C9H11N7O2 and a molecular weight of 249.23 g/mol. Its IUPAC name is 4-nitro-1-N-[1-(2H-tetrazol-5-yl)ethyl]benzene-1,3-diamine.
| Compound Name | 4-nitro-1-N-[1-(2H-tetrazol-5-yl)ethyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 106749198 |
| Molecular Formula | C9H11N7O2 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 4-nitro-1-N-[1-(2H-tetrazol-5-yl)ethyl]benzene-1,3-diamine |
| SMILES | CC(Nc1ccc([N+](=O)[O-])c(N)c1)c1nn[nH]n1 |
| InChI | InChI=1S/C9H11N7O2/c1-5(9-12-14-15-13-9)11-6-2-3-8(16(17)18)7(10)4-6/h2-5,11H,10H2,1H3,(H,12,13,14,15) |
| InChIKey | YYFKWYIYMGLWCU-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 135.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|