C10H9N7O2 — CID 104713608
4-nitro-3-[1-(2H-tetrazol-5-yl)ethylamino]benzonitrile (PubChem CID 104713608) has the molecular formula C10H9N7O2 and a molecular weight of 259.23 g/mol. Its IUPAC name is 4-nitro-3-[1-(2H-tetrazol-5-yl)ethylamino]benzonitrile.
| Compound Name | 4-nitro-3-[1-(2H-tetrazol-5-yl)ethylamino]benzonitrile |
|---|---|
| PubChem CID | 104713608 |
| Molecular Formula | C10H9N7O2 |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 4-nitro-3-[1-(2H-tetrazol-5-yl)ethylamino]benzonitrile |
| SMILES | CC(Nc1cc(C#N)ccc1[N+](=O)[O-])c1nn[nH]n1 |
| InChI | InChI=1S/C10H9N7O2/c1-6(10-13-15-16-14-10)12-8-4-7(5-11)2-3-9(8)17(18)19/h2-4,6,12H,1H3,(H,13,14,15,16) |
| InChIKey | TZTMWDUEZUUWFA-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 133.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|