C9H9FN6O2 — CID 115590428
4-fluoro-2-nitro-N-[1-(2H-tetrazol-5-yl)ethyl]aniline (PubChem CID 115590428) has the molecular formula C9H9FN6O2 and a molecular weight of 252.21 g/mol. Its IUPAC name is 4-fluoro-2-nitro-N-[1-(2H-tetrazol-5-yl)ethyl]aniline.
| Compound Name | 4-fluoro-2-nitro-N-[1-(2H-tetrazol-5-yl)ethyl]aniline |
|---|---|
| PubChem CID | 115590428 |
| Molecular Formula | C9H9FN6O2 |
| Molecular Weight | 252.21 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 4-fluoro-2-nitro-N-[1-(2H-tetrazol-5-yl)ethyl]aniline |
| SMILES | CC(Nc1ccc(F)cc1[N+](=O)[O-])c1nn[nH]n1 |
| InChI | InChI=1S/C9H9FN6O2/c1-5(9-12-14-15-13-9)11-7-3-2-6(10)4-8(7)16(17)18/h2-5,11H,1H3,(H,12,13,14,15) |
| InChIKey | ZYROQSYOIRQHFW-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 109.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.21 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|