C10H9ClN6 — CID 62495199
5-chloro-2-[1-(2H-tetrazol-5-yl)ethylamino]benzonitrile (PubChem CID 62495199) has the molecular formula C10H9ClN6 and a molecular weight of 248.68 g/mol. Its IUPAC name is 5-chloro-2-[1-(2H-tetrazol-5-yl)ethylamino]benzonitrile.
| Compound Name | 5-chloro-2-[1-(2H-tetrazol-5-yl)ethylamino]benzonitrile |
|---|---|
| PubChem CID | 62495199 |
| Molecular Formula | C10H9ClN6 |
| Molecular Weight | 248.68 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 5-chloro-2-[1-(2H-tetrazol-5-yl)ethylamino]benzonitrile |
| SMILES | CC(Nc1ccc(Cl)cc1C#N)c1nn[nH]n1 |
| InChI | InChI=1S/C10H9ClN6/c1-6(10-14-16-17-15-10)13-9-3-2-8(11)4-7(9)5-12/h2-4,6,13H,1H3,(H,14,15,16,17) |
| InChIKey | CHYMMEUZMSWRFE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.68 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |