C8H9ClN6 — CID 106194451
6-chloro-N-[1-(2H-tetrazol-5-yl)ethyl]pyridin-2-amine (PubChem CID 106194451) has the molecular formula C8H9ClN6 and a molecular weight of 224.66 g/mol. Its IUPAC name is 6-chloro-N-[1-(2H-tetrazol-5-yl)ethyl]pyridin-2-amine.
| Compound Name | 6-chloro-N-[1-(2H-tetrazol-5-yl)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 106194451 |
| Molecular Formula | C8H9ClN6 |
| Molecular Weight | 224.66 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 6-chloro-N-[1-(2H-tetrazol-5-yl)ethyl]pyridin-2-amine |
| SMILES | CC(Nc1cccc(Cl)n1)c1nn[nH]n1 |
| InChI | InChI=1S/C8H9ClN6/c1-5(8-12-14-15-13-8)10-7-4-2-3-6(9)11-7/h2-5H,1H3,(H,10,11)(H,12,13,14,15) |
| InChIKey | RZUPJJDNEJRKGV-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.66 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|