C10H12FN3O5S — CID 83116387
4-[2-(carbamoylamino)ethylsulfamoyl]-3-fluorobenzoic acid (PubChem CID 83116387) has the molecular formula C10H12FN3O5S and a molecular weight of 305.29 g/mol. Its IUPAC name is 4-[2-(carbamoylamino)ethylsulfamoyl]-3-fluorobenzoic acid.
| Compound Name | 4-[2-(carbamoylamino)ethylsulfamoyl]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 83116387 |
| Molecular Formula | C10H12FN3O5S |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 4-[2-(carbamoylamino)ethylsulfamoyl]-3-fluorobenzoic acid |
| SMILES | NC(=O)NCCNS(=O)(=O)c1ccc(C(=O)O)cc1F |
| InChI | InChI=1S/C10H12FN3O5S/c11-7-5-6(9(15)16)1-2-8(7)20(18,19)14-4-3-13-10(12)17/h1-2,5,14H,3-4H2,(H,15,16)(H3,12,13,17) |
| InChIKey | LYECSIAFRHAWKP-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|