C15H15F3N2O4S — CID 8817707
4-[[(1S)-1-(furan-2-yl)ethyl]sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 8817707) has the molecular formula C15H15F3N2O4S and a molecular weight of 376.36 g/mol. Its IUPAC name is 4-[[(1S)-1-(furan-2-yl)ethyl]sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-[[(1S)-1-(furan-2-yl)ethyl]sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 8817707 |
| Molecular Formula | C15H15F3N2O4S |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 4-[[(1S)-1-(furan-2-yl)ethyl]sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | C[C@H](NS(=O)(=O)c1ccc(C(=O)NCC(F)(F)F)cc1)c1ccco1 |
| InChI | InChI=1S/C15H15F3N2O4S/c1-10(13-3-2-8-24-13)20-25(22,23)12-6-4-11(5-7-12)14(21)19-9-15(16,17)18/h2-8,10,20H,9H2,1H3,(H,19,21)/t10-/m0/s1 |
| InChIKey | KTIPBJFMTWRYOX-JTQLQIEISA-N |
| XLogP | 2.61 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |